C28H36N4OS — CID 10528598
2,5,5-trimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one (PubChem CID 10528598) has the molecular formula C28H36N4OS and a molecular weight of 476.69 g/mol. Its IUPAC name is 2,5,5-trimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one.
| Compound Name | 2,5,5-trimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10528598 |
| Molecular Formula | C28H36N4OS |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 2,5,5-trimethyl-3-[4-[4-(1-phenylindol-3-yl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one |
| SMILES | CC1SC(C)(C)C(=O)N1CCCCN1CCN(c2cn(-c3ccccc3)c3ccccc23)CC1 |
| InChI | InChI=1S/C28H36N4OS/c1-22-31(27(33)28(2,3)34-22)16-10-9-15-29-17-19-30(20-18-29)26-21-32(23-11-5-4-6-12-23)25-14-8-7-13-24(25)26/h4-8,11-14,21-22H,9-10,15-20H2,1-3H3 |
| InChIKey | KQVBGTRXBYOVJC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 31.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|