C13H21FN2 — CID 105286424
[1-(3-fluorophenyl)-3-methylhexan-2-yl]hydrazine (PubChem CID 105286424) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is [1-(3-fluorophenyl)-3-methylhexan-2-yl]hydrazine.
| Compound Name | [1-(3-fluorophenyl)-3-methylhexan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105286424 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | [1-(3-fluorophenyl)-3-methylhexan-2-yl]hydrazine |
| SMILES | CCCC(C)C(Cc1cccc(F)c1)NN |
| InChI | InChI=1S/C13H21FN2/c1-3-5-10(2)13(16-15)9-11-6-4-7-12(14)8-11/h4,6-8,10,13,16H,3,5,9,15H2,1-2H3 |
| InChIKey | UESYOVIBNBLAFA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|