C17H19N3O — CID 105286887
[quinolin-3-yl-(2,4,5-trimethylfuran-3-yl)methyl]hydrazine (PubChem CID 105286887) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is [quinolin-3-yl-(2,4,5-trimethylfuran-3-yl)methyl]hydrazine.
| Compound Name | [quinolin-3-yl-(2,4,5-trimethylfuran-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105286887 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | [quinolin-3-yl-(2,4,5-trimethylfuran-3-yl)methyl]hydrazine |
| SMILES | Cc1oc(C)c(C(NN)c2cnc3ccccc3c2)c1C |
| InChI | InChI=1S/C17H19N3O/c1-10-11(2)21-12(3)16(10)17(20-18)14-8-13-6-4-5-7-15(13)19-9-14/h4-9,17,20H,18H2,1-3H3 |
| InChIKey | RIOQKCIMPVNYIA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|