C11H16FN3O — CID 105288195
[(5-fluoro-3-pyridinyl)-(5-methyloxolan-2-yl)methyl]hydrazine (PubChem CID 105288195) has the molecular formula C11H16FN3O and a molecular weight of 225.27 g/mol. Its IUPAC name is [(5-fluoro-3-pyridinyl)-(5-methyloxolan-2-yl)methyl]hydrazine.
| Compound Name | [(5-fluoro-3-pyridinyl)-(5-methyloxolan-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105288195 |
| Molecular Formula | C11H16FN3O |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | [(5-fluoro-3-pyridinyl)-(5-methyloxolan-2-yl)methyl]hydrazine |
| SMILES | CC1CCC(C(NN)c2cncc(F)c2)O1 |
| InChI | InChI=1S/C11H16FN3O/c1-7-2-3-10(16-7)11(15-13)8-4-9(12)6-14-5-8/h4-7,10-11,15H,2-3,13H2,1H3 |
| InChIKey | HUSGBAPAYNUZSB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|