C26H45NO7 — CID 10528843
[(3aS,4R,6R,6aR)-5-acetyl-6-(13-methoxy-10-oxotridecyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl acetate (PubChem CID 10528843) has the molecular formula C26H45NO7 and a molecular weight of 483.65 g/mol. Its IUPAC name is [(3aS,4R,6R,6aR)-5-acetyl-6-(13-methoxy-10-oxotridecyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl acetate.
| Compound Name | [(3aS,4R,6R,6aR)-5-acetyl-6-(13-methoxy-10-oxotridecyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl acetate |
|---|---|
| PubChem CID | 10528843 |
| Molecular Formula | C26H45NO7 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.32 |
| IUPAC Name | [(3aS,4R,6R,6aR)-5-acetyl-6-(13-methoxy-10-oxotridecyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl acetate |
| SMILES | COCCCC(=O)CCCCCCCCC[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@@H](COC(C)=O)N1C(C)=O |
| InChI | InChI=1S/C26H45NO7/c1-19(28)27-22(24-25(34-26(3,4)33-24)23(27)18-32-20(2)29)16-12-10-8-6-7-9-11-14-21(30)15-13-17-31-5/h22-25H,6-18H2,1-5H3/t22-,23-,24-,25+/m1/s1 |
| InChIKey | GRKIGIGONALGEQ-VPBXCIAMSA-N |
| XLogP | 4.18 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|