C22H28O12 — CID 10528860
dimethyl (1R,2R,7S,8S)-1,4,6,6,12,12-hexamethoxy-5,11-dioxotricyclo[6.2.2.02,7]dodeca-3,9-diene-2,9-dicarboxylate (PubChem CID 10528860) has the molecular formula C22H28O12 and a molecular weight of 484.45 g/mol. Its IUPAC name is dimethyl (1R,2R,7S,8S)-1,4,6,6,12,12-hexamethoxy-5,11-dioxotricyclo[6.2.2.02,7]dodeca-3,9-diene-2,9-dicarboxylate.
| Compound Name | dimethyl (1R,2R,7S,8S)-1,4,6,6,12,12-hexamethoxy-5,11-dioxotricyclo[6.2.2.02,7]dodeca-3,9-diene-2,9-dicarboxylate |
|---|---|
| PubChem CID | 10528860 |
| Molecular Formula | C22H28O12 |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | dimethyl (1R,2R,7S,8S)-1,4,6,6,12,12-hexamethoxy-5,11-dioxotricyclo[6.2.2.02,7]dodeca-3,9-diene-2,9-dicarboxylate |
| SMILES | COC(=O)C1=C[C@]2(OC)C(=O)C(OC)(OC)[C@H]1[C@@H]1C(OC)(OC)C(=O)C(OC)=C[C@@]12C(=O)OC |
| InChI | InChI=1S/C22H28O12/c1-27-12-10-19(18(26)29-3)14(22(33-7,34-8)15(12)23)13-11(16(24)28-2)9-20(19,30-4)17(25)21(13,31-5)32-6/h9-10,13-14H,1-8H3/t13-,14+,19+,20+/m1/s1 |
| InChIKey | VQLGTZSSQRAKSG-NIHZBZNOSA-N |
| XLogP | -0.45 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|