C25H41O7P — CID 10528867
5-(diethoxyphosphorylmethyl)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3-bis(methoxymethoxy)benzene (PubChem CID 10528867) has the molecular formula C25H41O7P and a molecular weight of 484.57 g/mol. Its IUPAC name is 5-(diethoxyphosphorylmethyl)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3-bis(methoxymethoxy)benzene.
| Compound Name | 5-(diethoxyphosphorylmethyl)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3-bis(methoxymethoxy)benzene |
|---|---|
| PubChem CID | 10528867 |
| Molecular Formula | C25H41O7P |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 5-(diethoxyphosphorylmethyl)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3-bis(methoxymethoxy)benzene |
| SMILES | CCOP(=O)(Cc1cc(OCOC)c(C/C=C(\C)CCC=C(C)C)c(OCOC)c1)OCC |
| InChI | InChI=1S/C25H41O7P/c1-8-31-33(26,32-9-2)17-22-15-24(29-18-27-6)23(25(16-22)30-19-28-7)14-13-21(5)12-10-11-20(3)4/h11,13,15-16H,8-10,12,14,17-19H2,1-7H3/b21-13+ |
| InChIKey | IAEPJLLZTAHYJN-FYJGNVAPSA-N |
| XLogP | 6.65 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|