C27H24N4O3S — CID 10528869
2-butyl-3-[[4-[2-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylic acid (PubChem CID 10528869) has the molecular formula C27H24N4O3S and a molecular weight of 484.58 g/mol. Its IUPAC name is 2-butyl-3-[[4-[2-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylic acid.
| Compound Name | 2-butyl-3-[[4-[2-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 10528869 |
| Molecular Formula | C27H24N4O3S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 2-butyl-3-[[4-[2-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylic acid |
| SMILES | CCCCc1nc2cccc(C(=O)O)c2n1Cc1ccc(-c2ccccc2-c2nc(=S)o[nH]2)cc1 |
| InChI | InChI=1S/C27H24N4O3S/c1-2-3-11-23-28-22-10-6-9-21(26(32)33)24(22)31(23)16-17-12-14-18(15-13-17)19-7-4-5-8-20(19)25-29-27(35)34-30-25/h4-10,12-15H,2-3,11,16H2,1H3,(H,32,33)(H,29,30,35) |
| InChIKey | HYAXYHNNVWDVDK-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|