C14H20N4 — CID 105288719
[(1-methylpyrazol-4-yl)-(2,4,6-trimethylphenyl)methyl]hydrazine (PubChem CID 105288719) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is [(1-methylpyrazol-4-yl)-(2,4,6-trimethylphenyl)methyl]hydrazine.
| Compound Name | [(1-methylpyrazol-4-yl)-(2,4,6-trimethylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105288719 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | [(1-methylpyrazol-4-yl)-(2,4,6-trimethylphenyl)methyl]hydrazine |
| SMILES | Cc1cc(C)c(C(NN)c2cnn(C)c2)c(C)c1 |
| InChI | InChI=1S/C14H20N4/c1-9-5-10(2)13(11(3)6-9)14(17-15)12-7-16-18(4)8-12/h5-8,14,17H,15H2,1-4H3 |
| InChIKey | PJWZZUHULNFEJX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|