About [(4,4-difluorocyclohexyl)-(1-methylpyrazol-4-yl)methyl]hydrazine
[(4,4-difluorocyclohexyl)-(1-methylpyrazol-4-yl)methyl]hydrazine (PubChem CID 105288751) has the molecular formula C11H18F2N4
and a molecular weight of 244.29 g/mol. Its IUPAC name is [(4,4-difluorocyclohexyl)-(1-methylpyrazol-4-yl)methyl]hydrazine.
Molecular Properties
| Compound Name | [(4,4-difluorocyclohexyl)-(1-methylpyrazol-4-yl)methyl]hydrazine |
| PubChem CID | 105288751 |
| Molecular Formula | C11H18F2N4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | [(4,4-difluorocyclohexyl)-(1-methylpyrazol-4-yl)methyl]hydrazine |
| SMILES | Cn1cc(C(NN)C2CCC(F)(F)CC2)cn1 |
| InChI | InChI=1S/C11H18F2N4/c1-17-7-9(6-15-17)10(16-14)8-2-4-11(12,13)5-3-8/h6-8,10,16H,2-5,14H2,1H3 |
| InChIKey | ZVOODWBNJWVDQP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4,4-difluorocyclohexyl)-(1-methylpyrazol-4-yl)methyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4,4-difluorocyclohexyl)-(1-methylpyrazol-4-yl)methyl]hydrazine?
The IUPAC name of [(4,4-difluorocyclohexyl)-(1-methylpyrazol-4-yl)methyl]hydrazine (CID 105288751) is [(4,4-difluorocyclohexyl)-(1-methylpyrazol-4-yl)methyl]hydrazine.
What is the SMILES notation for [(4,4-difluorocyclohexyl)-(1-methylpyrazol-4-yl)methyl]hydrazine?
The canonical SMILES for [(4,4-difluorocyclohexyl)-(1-methylpyrazol-4-yl)methyl]hydrazine is Cn1cc(C(NN)C2CCC(F)(F)CC2)cn1.
What is the InChIKey of [(4,4-difluorocyclohexyl)-(1-methylpyrazol-4-yl)methyl]hydrazine?
The InChIKey is ZVOODWBNJWVDQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F2N4/c1-17-7-9(6-15-17)10(16-14)8-2-4-11(12,13)5-3-8/h6-8,10,16H,2-5,14H2,1H3.
What are the key properties of [(4,4-difluorocyclohexyl)-(1-methylpyrazol-4-yl)methyl]hydrazine?
[(4,4-difluorocyclohexyl)-(1-methylpyrazol-4-yl)methyl]hydrazine has a molecular weight of 244.29 g/mol, XLogP of 1.75, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4,4-difluorocyclohexyl)-(1-methylpyrazol-4-yl)methyl]hydrazine is sourced from PubChem (CID 105288751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).