C12H18N2S — CID 105289523
1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)but-3-enylhydrazine (PubChem CID 105289523) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is 1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)but-3-enylhydrazine.
| Compound Name | 1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)but-3-enylhydrazine |
|---|---|
| PubChem CID | 105289523 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)but-3-enylhydrazine |
| SMILES | C=CCC(NN)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C12H18N2S/c1-2-5-10(14-13)12-8-9-6-3-4-7-11(9)15-12/h2,8,10,14H,1,3-7,13H2 |
| InChIKey | CQPBHMBLIJHCNH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|