C29H21N5OS — CID 10528981
3-phenyl-2-[[4-phenyl-6-[(E)-2-phenylethenyl]-1H-pyrazolo[3,4-b]pyridin-3-yl]imino]-1,3-thiazolidin-4-one (PubChem CID 10528981) has the molecular formula C29H21N5OS and a molecular weight of 487.59 g/mol. Its IUPAC name is 3-phenyl-2-[[4-phenyl-6-[(E)-2-phenylethenyl]-1H-pyrazolo[3,4-b]pyridin-3-yl]imino]-1,3-thiazolidin-4-one.
| Compound Name | 3-phenyl-2-[[4-phenyl-6-[(E)-2-phenylethenyl]-1H-pyrazolo[3,4-b]pyridin-3-yl]imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10528981 |
| Molecular Formula | C29H21N5OS |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 3-phenyl-2-[[4-phenyl-6-[(E)-2-phenylethenyl]-1H-pyrazolo[3,4-b]pyridin-3-yl]imino]-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N\c2n[nH]c3nc(/C=C/c4ccccc4)cc(-c4ccccc4)c23)N1c1ccccc1 |
| InChI | InChI=1S/C29H21N5OS/c35-25-19-36-29(34(25)23-14-8-3-9-15-23)31-28-26-24(21-12-6-2-7-13-21)18-22(30-27(26)32-33-28)17-16-20-10-4-1-5-11-20/h1-18H,19H2,(H,30,32,33)/b17-16+,31-29- |
| InChIKey | ZNIKVOJSZUNVTN-KXZKTXGOSA-N |
| XLogP | 6.56 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|