C13H18BrFN2O — CID 105290501
[2-(3-bromo-4-fluorophenyl)-1-(5-methyloxolan-2-yl)ethyl]hydrazine (PubChem CID 105290501) has the molecular formula C13H18BrFN2O and a molecular weight of 317.20 g/mol. Its IUPAC name is [2-(3-bromo-4-fluorophenyl)-1-(5-methyloxolan-2-yl)ethyl]hydrazine.
| Compound Name | [2-(3-bromo-4-fluorophenyl)-1-(5-methyloxolan-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105290501 |
| Molecular Formula | C13H18BrFN2O |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | [2-(3-bromo-4-fluorophenyl)-1-(5-methyloxolan-2-yl)ethyl]hydrazine |
| SMILES | CC1CCC(C(Cc2ccc(F)c(Br)c2)NN)O1 |
| InChI | InChI=1S/C13H18BrFN2O/c1-8-2-5-13(18-8)12(17-16)7-9-3-4-11(15)10(14)6-9/h3-4,6,8,12-13,17H,2,5,7,16H2,1H3 |
| InChIKey | GSALJIANPLSGHN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|