C30H33N2S+ — CID 10529053
[4-[6-[4-(dimethylamino)phenyl]-4-(2,4,6-trimethylphenyl)thiopyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 10529053) has the molecular formula C30H33N2S+ and a molecular weight of 453.68 g/mol. Its IUPAC name is [4-[6-[4-(dimethylamino)phenyl]-4-(2,4,6-trimethylphenyl)thiopyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[6-[4-(dimethylamino)phenyl]-4-(2,4,6-trimethylphenyl)thiopyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 10529053 |
| Molecular Formula | C30H33N2S+ |
| Molecular Weight | 453.68 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | [4-[6-[4-(dimethylamino)phenyl]-4-(2,4,6-trimethylphenyl)thiopyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | Cc1cc(C)c(C2=CC(=C3C=CC(=[N+](C)C)C=C3)SC(c3ccc(N(C)C)cc3)=C2)c(C)c1 |
| InChI | InChI=1S/C30H33N2S/c1-20-16-21(2)30(22(3)17-20)25-18-28(23-8-12-26(13-9-23)31(4)5)33-29(19-25)24-10-14-27(15-11-24)32(6)7/h8-19H,1-7H3/q+1 |
| InChIKey | XBRLJACVZXSHFU-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.68 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|