C28H37Cl2NO2 — CID 10529089
(4R,5S)-5-benzyl-3,3-dichloro-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one (PubChem CID 10529089) has the molecular formula C28H37Cl2NO2 and a molecular weight of 490.52 g/mol. Its IUPAC name is (4R,5S)-5-benzyl-3,3-dichloro-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one.
| Compound Name | (4R,5S)-5-benzyl-3,3-dichloro-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one |
|---|---|
| PubChem CID | 10529089 |
| Molecular Formula | C28H37Cl2NO2 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | (4R,5S)-5-benzyl-3,3-dichloro-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one |
| SMILES | CC(C)c1cc(C(C)C)c([C@@H](C)O[C@@H]2[C@H](Cc3ccccc3)NC(=O)C2(Cl)Cl)c(C(C)C)c1 |
| InChI | InChI=1S/C28H37Cl2NO2/c1-16(2)21-14-22(17(3)4)25(23(15-21)18(5)6)19(7)33-26-24(31-27(32)28(26,29)30)13-20-11-9-8-10-12-20/h8-12,14-19,24,26H,13H2,1-7H3,(H,31,32)/t19-,24+,26-/m1/s1 |
| InChIKey | LWWNAXPNLQOERA-YZXAJQSBSA-N |
| XLogP | 7.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|