C18H24N2O — CID 105292611
[(2,5-dimethylphenyl)-(3-propoxyphenyl)methyl]hydrazine (PubChem CID 105292611) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is [(2,5-dimethylphenyl)-(3-propoxyphenyl)methyl]hydrazine.
| Compound Name | [(2,5-dimethylphenyl)-(3-propoxyphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105292611 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | [(2,5-dimethylphenyl)-(3-propoxyphenyl)methyl]hydrazine |
| SMILES | CCCOc1cccc(C(NN)c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C18H24N2O/c1-4-10-21-16-7-5-6-15(12-16)18(20-19)17-11-13(2)8-9-14(17)3/h5-9,11-12,18,20H,4,10,19H2,1-3H3 |
| InChIKey | AHENYSGOQXXNTP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|