C29H40O5Si — CID 10529296
trans-dimethyl (3R,5S)-5-[[tert-butyl(diphenyl)silyl]methyl]-3-methoxy-2,2-dimethylcyclopentane-1,1-dicarboxylate (PubChem CID 10529296) has the molecular formula C29H40O5Si and a molecular weight of 496.72 g/mol. Its IUPAC name is trans-dimethyl (3R,5S)-5-[[tert-butyl(diphenyl)silyl]methyl]-3-methoxy-2,2-dimethylcyclopentane-1,1-dicarboxylate.
| Compound Name | trans-dimethyl (3R,5S)-5-[[tert-butyl(diphenyl)silyl]methyl]-3-methoxy-2,2-dimethylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10529296 |
| Molecular Formula | C29H40O5Si |
| Molecular Weight | 496.72 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | trans-dimethyl (3R,5S)-5-[[tert-butyl(diphenyl)silyl]methyl]-3-methoxy-2,2-dimethylcyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@@H](C[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H](OC)C1(C)C |
| InChI | InChI=1S/C29H40O5Si/c1-27(2,3)35(22-15-11-9-12-16-22,23-17-13-10-14-18-23)20-21-19-24(32-6)28(4,5)29(21,25(30)33-7)26(31)34-8/h9-18,21,24H,19-20H2,1-8H3/t21-,24-/m1/s1 |
| InChIKey | ZQZJHZGWTGNMNE-ZJSXRUAMSA-N |
| XLogP | 4.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.72 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|