C17H27FN2O — CID 105292967
[1-cycloheptyl-3-(3-fluoro-4-methoxyphenyl)propan-2-yl]hydrazine (PubChem CID 105292967) has the molecular formula C17H27FN2O and a molecular weight of 294.41 g/mol. Its IUPAC name is [1-cycloheptyl-3-(3-fluoro-4-methoxyphenyl)propan-2-yl]hydrazine.
| Compound Name | [1-cycloheptyl-3-(3-fluoro-4-methoxyphenyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105292967 |
| Molecular Formula | C17H27FN2O |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | [1-cycloheptyl-3-(3-fluoro-4-methoxyphenyl)propan-2-yl]hydrazine |
| SMILES | COc1ccc(CC(CC2CCCCCC2)NN)cc1F |
| InChI | InChI=1S/C17H27FN2O/c1-21-17-9-8-14(12-16(17)18)11-15(20-19)10-13-6-4-2-3-5-7-13/h8-9,12-13,15,20H,2-7,10-11,19H2,1H3 |
| InChIKey | YJJLNYMQYXWMNV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|