C21H31N5O7S — CID 10529317
(2S)-3-[[5-[4-(carbamoylamino)butyl]-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid (PubChem CID 10529317) has the molecular formula C21H31N5O7S and a molecular weight of 497.57 g/mol. Its IUPAC name is (2S)-3-[[5-[4-(carbamoylamino)butyl]-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-3-[[5-[4-(carbamoylamino)butyl]-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 10529317 |
| Molecular Formula | C21H31N5O7S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | (2S)-3-[[5-[4-(carbamoylamino)butyl]-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)N[C@@H](CNC(=O)C2=NOC(CCCCNC(N)=O)C2)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C21H31N5O7S/c1-12-8-13(2)18(14(3)9-12)34(31,32)26-17(20(28)29)11-24-19(27)16-10-15(33-25-16)6-4-5-7-23-21(22)30/h8-9,15,17,26H,4-7,10-11H2,1-3H3,(H,24,27)(H,28,29)(H3,22,23,30)/t15?,17-/m0/s1 |
| InChIKey | WIHMEUNVCQPVOZ-LWKPJOBUSA-N |
| XLogP | 0.44 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|