C16H32N2 — CID 105294571
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)hexylhydrazine (PubChem CID 105294571) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)hexylhydrazine.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)hexylhydrazine |
|---|---|
| PubChem CID | 105294571 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)hexylhydrazine |
| SMILES | CCCCCC(NN)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C16H32N2/c1-2-3-4-9-16(18-17)15-11-10-13-7-5-6-8-14(13)12-15/h13-16,18H,2-12,17H2,1H3 |
| InChIKey | YGQQVDQJUGJWRX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|