C15H30N2 — CID 105296165
1,3-dicyclohexylpropan-2-ylhydrazine (PubChem CID 105296165) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is 1,3-dicyclohexylpropan-2-ylhydrazine.
| Compound Name | 1,3-dicyclohexylpropan-2-ylhydrazine |
|---|---|
| PubChem CID | 105296165 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 1,3-dicyclohexylpropan-2-ylhydrazine |
| SMILES | NNC(CC1CCCCC1)CC1CCCCC1 |
| InChI | InChI=1S/C15H30N2/c16-17-15(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h13-15,17H,1-12,16H2 |
| InChIKey | UXSQHZHARFCSMI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|