C12H15ClN2S2 — CID 105296380
[1-(5-chlorothiophen-2-yl)-2-(5-ethylthiophen-2-yl)ethyl]hydrazine (PubChem CID 105296380) has the molecular formula C12H15ClN2S2 and a molecular weight of 286.85 g/mol. Its IUPAC name is [1-(5-chlorothiophen-2-yl)-2-(5-ethylthiophen-2-yl)ethyl]hydrazine.
| Compound Name | [1-(5-chlorothiophen-2-yl)-2-(5-ethylthiophen-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105296380 |
| Molecular Formula | C12H15ClN2S2 |
| Molecular Weight | 286.85 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | [1-(5-chlorothiophen-2-yl)-2-(5-ethylthiophen-2-yl)ethyl]hydrazine |
| SMILES | CCc1ccc(CC(NN)c2ccc(Cl)s2)s1 |
| InChI | InChI=1S/C12H15ClN2S2/c1-2-8-3-4-9(16-8)7-10(15-14)11-5-6-12(13)17-11/h3-6,10,15H,2,7,14H2,1H3 |
| InChIKey | GDUSGTWZCGMAAM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.85 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|