C28H52O4Si2 — CID 10529659
(1R,2R,3E,7S,11E,13S,15S)-2,15-bis[[tert-butyl(dimethyl)silyl]oxy]-7-methyl-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one (PubChem CID 10529659) has the molecular formula C28H52O4Si2 and a molecular weight of 508.89 g/mol. Its IUPAC name is (1R,2R,3E,7S,11E,13S,15S)-2,15-bis[[tert-butyl(dimethyl)silyl]oxy]-7-methyl-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one.
| Compound Name | (1R,2R,3E,7S,11E,13S,15S)-2,15-bis[[tert-butyl(dimethyl)silyl]oxy]-7-methyl-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
|---|---|
| PubChem CID | 10529659 |
| Molecular Formula | C28H52O4Si2 |
| Molecular Weight | 508.89 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | (1R,2R,3E,7S,11E,13S,15S)-2,15-bis[[tert-butyl(dimethyl)silyl]oxy]-7-methyl-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
| SMILES | C[C@H]1CCC/C=C/[C@@H]2C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)/C=C/C(=O)O1 |
| InChI | InChI=1S/C28H52O4Si2/c1-21-15-13-12-14-16-22-19-23(31-33(8,9)27(2,3)4)20-24(22)25(17-18-26(29)30-21)32-34(10,11)28(5,6)7/h14,16-18,21-25H,12-13,15,19-20H2,1-11H3/b16-14+,18-17+/t21-,22+,23-,24+,25+/m0/s1 |
| InChIKey | BHSFBJFMIRDDEL-ZUVJBVEQSA-N |
| XLogP | 8.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.89 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|