C32H31NO5 — CID 10529675
[(1R,3R)-7-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-2-formyl-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-8-yl] benzoate (PubChem CID 10529675) has the molecular formula C32H31NO5 and a molecular weight of 509.60 g/mol. Its IUPAC name is [(1R,3R)-7-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-2-formyl-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-8-yl] benzoate.
| Compound Name | [(1R,3R)-7-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-2-formyl-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-8-yl] benzoate |
|---|---|
| PubChem CID | 10529675 |
| Molecular Formula | C32H31NO5 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | [(1R,3R)-7-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-2-formyl-1,3-dimethyl-3,4-dihydro-1H-isoquinolin-8-yl] benzoate |
| SMILES | COc1cccc2c(-c3ccc4c(c3OC(=O)c3ccccc3)[C@@H](C)N(C=O)[C@H](C)C4)c(C)cc(OC)c12 |
| InChI | InChI=1S/C32H31NO5/c1-19-16-27(37-5)30-24(12-9-13-26(30)36-4)28(19)25-15-14-23-17-20(2)33(18-34)21(3)29(23)31(25)38-32(35)22-10-7-6-8-11-22/h6-16,18,20-21H,17H2,1-5H3/t20-,21-/m1/s1 |
| InChIKey | URWYBMRYWURITF-NHCUHLMSSA-N |
| XLogP | 6.52 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|