C28H36O5SSi — CID 10529768
(1R,3R,8S,9S)-13-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyl-15-oxatetracyclo[7.5.1.01,11.03,8]pentadeca-5,10,12-trien-2-one (PubChem CID 10529768) has the molecular formula C28H36O5SSi and a molecular weight of 512.74 g/mol. Its IUPAC name is (1R,3R,8S,9S)-13-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyl-15-oxatetracyclo[7.5.1.01,11.03,8]pentadeca-5,10,12-trien-2-one.
| Compound Name | (1R,3R,8S,9S)-13-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyl-15-oxatetracyclo[7.5.1.01,11.03,8]pentadeca-5,10,12-trien-2-one |
|---|---|
| PubChem CID | 10529768 |
| Molecular Formula | C28H36O5SSi |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | (1R,3R,8S,9S)-13-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyl-15-oxatetracyclo[7.5.1.01,11.03,8]pentadeca-5,10,12-trien-2-one |
| SMILES | CC1=C(C)C[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)[C@@]34CC(S(=O)(=O)c5ccccc5)=CC3=C[C@H](O4)[C@@H]2C1 |
| InChI | InChI=1S/C28H36O5SSi/c1-18-13-23-24-15-20-14-22(34(30,31)21-11-9-8-10-12-21)17-27(20,32-24)25(29)28(23,16-19(18)2)33-35(6,7)26(3,4)5/h8-12,14-15,23-24H,13,16-17H2,1-7H3/t23-,24-,27+,28+/m0/s1 |
| InChIKey | UEQSDFFIQXTFTF-KBJUPQRZSA-N |
| XLogP | 5.90 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|