About CID 10529819
CID 10529819 (PubChem CID 10529819) has the molecular formula C29H38O8
and a molecular weight of 514.62 g/mol.
Molecular Properties
| Compound Name | CID 10529819 |
| PubChem CID | 10529819 |
| Molecular Formula | C29H38O8 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | — |
| SMILES | CC(=O)O[C@H]1CC(=O)OC(C)(C)[C@@H]2CC[C@]3(C)[C@H](CC=C(C)[C@@]34C[C@]3(OC(C)=C(C)C3=O)C(=O)O4)[C@@]12C |
| InChI | InChI=1S/C29H38O8/c1-15-9-10-20-26(7,29(15)14-28(24(33)37-29)23(32)16(2)17(3)35-28)12-11-19-25(5,6)36-22(31)13-21(27(19,20)8)34-18(4)30/h9,19-21H,10-14H2,1-8H3/t19-,20-,21-,26+,27-,28+,29-/m0/s1 |
| InChIKey | SAYCZGIAVNNJNU-QUDATIDPSA-N |
| XLogP | 4.35 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 10529819 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10529819?
The IUPAC name of CID 10529819 (CID 10529819) is not available.
What is the SMILES notation for CID 10529819?
The canonical SMILES for CID 10529819 is CC(=O)O[C@H]1CC(=O)OC(C)(C)[C@@H]2CC[C@]3(C)[C@H](CC=C(C)[C@@]34C[C@]3(OC(C)=C(C)C3=O)C(=O)O4)[C@@]12C.
What is the InChIKey of CID 10529819?
The InChIKey is SAYCZGIAVNNJNU-QUDATIDPSA-N. The full InChI is InChI=1S/C29H38O8/c1-15-9-10-20-26(7,29(15)14-28(24(33)37-29)23(32)16(2)17(3)35-28)12-11-19-25(5,6)36-22(31)13-21(27(19,20)8)34-18(4)30/h9,19-21H,10-14H2,1-8H3/t19-,20-,21-,26+,27-,28+,29-/m0/s1.
What are the key properties of CID 10529819?
CID 10529819 has a molecular weight of 514.62 g/mol, XLogP of 4.35, 1 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10529819 is sourced from PubChem (CID 10529819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).