C34H36N2O3 — CID 10529985
tert-butyl (2S)-6-hydroxy-2-[(9-phenylfluoren-9-yl)amino]-6-pyridin-2-ylhexanoate (PubChem CID 10529985) has the molecular formula C34H36N2O3 and a molecular weight of 520.67 g/mol. Its IUPAC name is tert-butyl (2S)-6-hydroxy-2-[(9-phenylfluoren-9-yl)amino]-6-pyridin-2-ylhexanoate.
| Compound Name | tert-butyl (2S)-6-hydroxy-2-[(9-phenylfluoren-9-yl)amino]-6-pyridin-2-ylhexanoate |
|---|---|
| PubChem CID | 10529985 |
| Molecular Formula | C34H36N2O3 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | tert-butyl (2S)-6-hydroxy-2-[(9-phenylfluoren-9-yl)amino]-6-pyridin-2-ylhexanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCC(O)c1ccccn1)NC1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C34H36N2O3/c1-33(2,3)39-32(38)30(21-13-22-31(37)29-20-11-12-23-35-29)36-34(24-14-5-4-6-15-24)27-18-9-7-16-25(27)26-17-8-10-19-28(26)34/h4-12,14-20,23,30-31,36-37H,13,21-22H2,1-3H3/t30-,31?/m0/s1 |
| InChIKey | FCLHPOXOGUCOQK-FSRLHOSWSA-N |
| XLogP | 6.56 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |