C12H26N2S — CID 105300099
[4,4-dimethyl-1-(2-methylthiolan-2-yl)pentyl]hydrazine (PubChem CID 105300099) has the molecular formula C12H26N2S and a molecular weight of 230.42 g/mol. Its IUPAC name is [4,4-dimethyl-1-(2-methylthiolan-2-yl)pentyl]hydrazine.
| Compound Name | [4,4-dimethyl-1-(2-methylthiolan-2-yl)pentyl]hydrazine |
|---|---|
| PubChem CID | 105300099 |
| Molecular Formula | C12H26N2S |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | [4,4-dimethyl-1-(2-methylthiolan-2-yl)pentyl]hydrazine |
| SMILES | CC(C)(C)CCC(NN)C1(C)CCCS1 |
| InChI | InChI=1S/C12H26N2S/c1-11(2,3)8-6-10(14-13)12(4)7-5-9-15-12/h10,14H,5-9,13H2,1-4H3 |
| InChIKey | FJCWMPNHCYHVSH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|