C14H18N2OS — CID 105300329
[(3,4-dimethylphenyl)-(4-methoxythiophen-2-yl)methyl]hydrazine (PubChem CID 105300329) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is [(3,4-dimethylphenyl)-(4-methoxythiophen-2-yl)methyl]hydrazine.
| Compound Name | [(3,4-dimethylphenyl)-(4-methoxythiophen-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105300329 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | [(3,4-dimethylphenyl)-(4-methoxythiophen-2-yl)methyl]hydrazine |
| SMILES | COc1csc(C(NN)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C14H18N2OS/c1-9-4-5-11(6-10(9)2)14(16-15)13-7-12(17-3)8-18-13/h4-8,14,16H,15H2,1-3H3 |
| InChIKey | SLEJADUSEGENGA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|