C16H26N2O — CID 105300777
[(4-ethoxyphenyl)-(2,2,3,3-tetramethylcyclopropyl)methyl]hydrazine (PubChem CID 105300777) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is [(4-ethoxyphenyl)-(2,2,3,3-tetramethylcyclopropyl)methyl]hydrazine.
| Compound Name | [(4-ethoxyphenyl)-(2,2,3,3-tetramethylcyclopropyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105300777 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | [(4-ethoxyphenyl)-(2,2,3,3-tetramethylcyclopropyl)methyl]hydrazine |
| SMILES | CCOc1ccc(C(NN)C2C(C)(C)C2(C)C)cc1 |
| InChI | InChI=1S/C16H26N2O/c1-6-19-12-9-7-11(8-10-12)13(18-17)14-15(2,3)16(14,4)5/h7-10,13-14,18H,6,17H2,1-5H3 |
| InChIKey | SQTRGIHZYPOZBF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|