C13H13F3N2O2S — CID 105301473
[(3-methoxythiophen-2-yl)-[2-(trifluoromethoxy)phenyl]methyl]hydrazine (PubChem CID 105301473) has the molecular formula C13H13F3N2O2S and a molecular weight of 318.32 g/mol. Its IUPAC name is [(3-methoxythiophen-2-yl)-[2-(trifluoromethoxy)phenyl]methyl]hydrazine.
| Compound Name | [(3-methoxythiophen-2-yl)-[2-(trifluoromethoxy)phenyl]methyl]hydrazine |
|---|---|
| PubChem CID | 105301473 |
| Molecular Formula | C13H13F3N2O2S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | [(3-methoxythiophen-2-yl)-[2-(trifluoromethoxy)phenyl]methyl]hydrazine |
| SMILES | COc1ccsc1C(NN)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O2S/c1-19-10-6-7-21-12(10)11(18-17)8-4-2-3-5-9(8)20-13(14,15)16/h2-7,11,18H,17H2,1H3 |
| InChIKey | AZLWNTMKTZMYKC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|