C12H11Br2FN2S — CID 105302870
[(4,5-dibromothiophen-2-yl)-(2-fluoro-5-methylphenyl)methyl]hydrazine (PubChem CID 105302870) has the molecular formula C12H11Br2FN2S and a molecular weight of 394.11 g/mol. Its IUPAC name is [(4,5-dibromothiophen-2-yl)-(2-fluoro-5-methylphenyl)methyl]hydrazine.
| Compound Name | [(4,5-dibromothiophen-2-yl)-(2-fluoro-5-methylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105302870 |
| Molecular Formula | C12H11Br2FN2S |
| Molecular Weight | 394.11 g/mol |
| Exact Mass | 391.90 |
| IUPAC Name | [(4,5-dibromothiophen-2-yl)-(2-fluoro-5-methylphenyl)methyl]hydrazine |
| SMILES | Cc1ccc(F)c(C(NN)c2cc(Br)c(Br)s2)c1 |
| InChI | InChI=1S/C12H11Br2FN2S/c1-6-2-3-9(15)7(4-6)11(17-16)10-5-8(13)12(14)18-10/h2-5,11,17H,16H2,1H3 |
| InChIKey | MPOHYXIEJRHFMA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.11 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|