C15H21N3 — CID 105303126
(1-isoquinolin-5-yl-2,2-dimethylbutyl)hydrazine (PubChem CID 105303126) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is (1-isoquinolin-5-yl-2,2-dimethylbutyl)hydrazine.
| Compound Name | (1-isoquinolin-5-yl-2,2-dimethylbutyl)hydrazine |
|---|---|
| PubChem CID | 105303126 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | (1-isoquinolin-5-yl-2,2-dimethylbutyl)hydrazine |
| SMILES | CCC(C)(C)C(NN)c1cccc2cnccc12 |
| InChI | InChI=1S/C15H21N3/c1-4-15(2,3)14(18-16)13-7-5-6-11-10-17-9-8-12(11)13/h5-10,14,18H,4,16H2,1-3H3 |
| InChIKey | UTLRKKCRCPYJMT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|