C15H15ClF2N2O — CID 105303167
[2-(3-chlorophenoxy)-1-(2,4-difluorophenyl)propyl]hydrazine (PubChem CID 105303167) has the molecular formula C15H15ClF2N2O and a molecular weight of 312.75 g/mol. Its IUPAC name is [2-(3-chlorophenoxy)-1-(2,4-difluorophenyl)propyl]hydrazine.
| Compound Name | [2-(3-chlorophenoxy)-1-(2,4-difluorophenyl)propyl]hydrazine |
|---|---|
| PubChem CID | 105303167 |
| Molecular Formula | C15H15ClF2N2O |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | [2-(3-chlorophenoxy)-1-(2,4-difluorophenyl)propyl]hydrazine |
| SMILES | CC(Oc1cccc(Cl)c1)C(NN)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H15ClF2N2O/c1-9(21-12-4-2-3-10(16)7-12)15(20-19)13-6-5-11(17)8-14(13)18/h2-9,15,20H,19H2,1H3 |
| InChIKey | MDEMMRSPWWMQGO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|