C27H34O9S — CID 10530369
2-[3-[2-[[(1R,2S,6S,7R,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]oxy]phenyl]phenyl]ethyl methanesulfonate (PubChem CID 10530369) has the molecular formula C27H34O9S and a molecular weight of 534.63 g/mol. Its IUPAC name is 2-[3-[2-[[(1R,2S,6S,7R,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]oxy]phenyl]phenyl]ethyl methanesulfonate.
| Compound Name | 2-[3-[2-[[(1R,2S,6S,7R,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]oxy]phenyl]phenyl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 10530369 |
| Molecular Formula | C27H34O9S |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 2-[3-[2-[[(1R,2S,6S,7R,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]oxy]phenyl]phenyl]ethyl methanesulfonate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Oc1ccccc1-c1cccc(CCOS(C)(=O)=O)c1)O[C@@H]1COC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C27H34O9S/c1-26(2)30-16-21-22(34-26)23-24(36-27(3,4)35-23)25(33-21)32-20-12-7-6-11-19(20)18-10-8-9-17(15-18)13-14-31-37(5,28)29/h6-12,15,21-25H,13-14,16H2,1-5H3/t21-,22-,23+,24+,25+/m1/s1 |
| InChIKey | DXOJFFVTUVGRHP-VAFBSOEGSA-N |
| XLogP | 3.65 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|