C28H48O8Si — CID 10530501
cis-dimethyl (3S,4S)-4-[(1R,2R)-4,4-bis(methoxycarbonyl)-2-(triethylsilylmethyl)cyclopentyl]-2,2,3-trimethylcyclopentane-1,1-dicarboxylate (PubChem CID 10530501) has the molecular formula C28H48O8Si and a molecular weight of 540.77 g/mol. Its IUPAC name is cis-dimethyl (3S,4S)-4-[(1R,2R)-4,4-bis(methoxycarbonyl)-2-(triethylsilylmethyl)cyclopentyl]-2,2,3-trimethylcyclopentane-1,1-dicarboxylate.
| Compound Name | cis-dimethyl (3S,4S)-4-[(1R,2R)-4,4-bis(methoxycarbonyl)-2-(triethylsilylmethyl)cyclopentyl]-2,2,3-trimethylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10530501 |
| Molecular Formula | C28H48O8Si |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | cis-dimethyl (3S,4S)-4-[(1R,2R)-4,4-bis(methoxycarbonyl)-2-(triethylsilylmethyl)cyclopentyl]-2,2,3-trimethylcyclopentane-1,1-dicarboxylate |
| SMILES | CC[Si](CC)(CC)C[C@@H]1CC(C(=O)OC)(C(=O)OC)C[C@@H]1[C@@H]1CC(C(=O)OC)(C(=O)OC)C(C)(C)[C@H]1C |
| InChI | InChI=1S/C28H48O8Si/c1-11-37(12-2,13-3)17-19-14-27(22(29)33-7,23(30)34-8)15-21(19)20-16-28(24(31)35-9,25(32)36-10)26(5,6)18(20)4/h18-21H,11-17H2,1-10H3/t18-,19-,20+,21-/m0/s1 |
| InChIKey | CHEOGUODBBJOTD-BURNTYAHSA-N |
| XLogP | 4.87 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|