C11H9BrF2N2O — CID 105305020
[(5-bromofuran-2-yl)-(3,4-difluorophenyl)methyl]hydrazine (PubChem CID 105305020) has the molecular formula C11H9BrF2N2O and a molecular weight of 303.11 g/mol. Its IUPAC name is [(5-bromofuran-2-yl)-(3,4-difluorophenyl)methyl]hydrazine.
| Compound Name | [(5-bromofuran-2-yl)-(3,4-difluorophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105305020 |
| Molecular Formula | C11H9BrF2N2O |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | [(5-bromofuran-2-yl)-(3,4-difluorophenyl)methyl]hydrazine |
| SMILES | NNC(c1ccc(F)c(F)c1)c1ccc(Br)o1 |
| InChI | InChI=1S/C11H9BrF2N2O/c12-10-4-3-9(17-10)11(16-15)6-1-2-7(13)8(14)5-6/h1-5,11,16H,15H2 |
| InChIKey | ZBHRLWOFGVLNJD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|