C8H20N2O2S — CID 105305321
(2,2-dimethyl-4-methylsulfonylpentan-3-yl)hydrazine (PubChem CID 105305321) has the molecular formula C8H20N2O2S and a molecular weight of 208.33 g/mol. Its IUPAC name is (2,2-dimethyl-4-methylsulfonylpentan-3-yl)hydrazine.
| Compound Name | (2,2-dimethyl-4-methylsulfonylpentan-3-yl)hydrazine |
|---|---|
| PubChem CID | 105305321 |
| Molecular Formula | C8H20N2O2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | (2,2-dimethyl-4-methylsulfonylpentan-3-yl)hydrazine |
| SMILES | CC(C(NN)C(C)(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C8H20N2O2S/c1-6(13(5,11)12)7(10-9)8(2,3)4/h6-7,10H,9H2,1-5H3 |
| InChIKey | XMMPDFUHUQBNFH-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|