C28H54O6Si2 — CID 10530543
2-[[(3aR,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]methyl]-3-[tert-butyl(dimethyl)silyl]oxyoctanoic acid (PubChem CID 10530543) has the molecular formula C28H54O6Si2 and a molecular weight of 542.91 g/mol. Its IUPAC name is 2-[[(3aR,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]methyl]-3-[tert-butyl(dimethyl)silyl]oxyoctanoic acid.
| Compound Name | 2-[[(3aR,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]methyl]-3-[tert-butyl(dimethyl)silyl]oxyoctanoic acid |
|---|---|
| PubChem CID | 10530543 |
| Molecular Formula | C28H54O6Si2 |
| Molecular Weight | 542.91 g/mol |
| Exact Mass | 542.35 |
| IUPAC Name | 2-[[(3aR,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]methyl]-3-[tert-butyl(dimethyl)silyl]oxyoctanoic acid |
| SMILES | CCCCCC(O[Si](C)(C)C(C)(C)C)C(C[C@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C28H54O6Si2/c1-12-13-14-15-22(33-35(8,9)27(2,3)4)21(26(30)31)16-19-20-17-25(29)32-23(20)18-24(19)34-36(10,11)28(5,6)7/h19-24H,12-18H2,1-11H3,(H,30,31)/t19-,20+,21?,22?,23-,24+/m0/s1 |
| InChIKey | WFTOCZROBJTDKM-DDBCRUGBSA-N |
| XLogP | 7.39 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.91 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|