C29H62O3Si3 — CID 10530547
(2R,4S,8R)-10-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxy-8-methyl-8-triethylsilyloxydec-5-yn-4-ol (PubChem CID 10530547) has the molecular formula C29H62O3Si3 and a molecular weight of 543.07 g/mol. Its IUPAC name is (2R,4S,8R)-10-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxy-8-methyl-8-triethylsilyloxydec-5-yn-4-ol.
| Compound Name | (2R,4S,8R)-10-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxy-8-methyl-8-triethylsilyloxydec-5-yn-4-ol |
|---|---|
| PubChem CID | 10530547 |
| Molecular Formula | C29H62O3Si3 |
| Molecular Weight | 543.07 g/mol |
| Exact Mass | 542.40 |
| IUPAC Name | (2R,4S,8R)-10-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxy-8-methyl-8-triethylsilyloxydec-5-yn-4-ol |
| SMILES | CC[Si](CC)(CC)O[C@](C)(CC#C[C@@H](O)C[C@@H](C)O[Si](C)(C)C(C)(C)C)CC[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H62O3Si3/c1-16-35(17-2,18-3)32-29(11,22-23-33(12,13)27(5,6)7)21-19-20-26(30)24-25(4)31-34(14,15)28(8,9)10/h25-26,30H,16-18,21-24H2,1-15H3/t25-,26-,29-/m1/s1 |
| InChIKey | CJSRQZLKXJFUGC-WWPJHQMMSA-N |
| XLogP | 9.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.07 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|