C30H33NO7S — CID 10530720
2-O-benzhydryl 1-O-tert-butyl (2R,4S)-4-(4-methylphenyl)sulfonyloxypyrrolidine-1,2-dicarboxylate (PubChem CID 10530720) has the molecular formula C30H33NO7S and a molecular weight of 551.66 g/mol. Its IUPAC name is 2-O-benzhydryl 1-O-tert-butyl (2R,4S)-4-(4-methylphenyl)sulfonyloxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-benzhydryl 1-O-tert-butyl (2R,4S)-4-(4-methylphenyl)sulfonyloxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10530720 |
| Molecular Formula | C30H33NO7S |
| Molecular Weight | 551.66 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | 2-O-benzhydryl 1-O-tert-butyl (2R,4S)-4-(4-methylphenyl)sulfonyloxypyrrolidine-1,2-dicarboxylate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2C[C@H](C(=O)OC(c3ccccc3)c3ccccc3)N(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C30H33NO7S/c1-21-15-17-25(18-16-21)39(34,35)38-24-19-26(31(20-24)29(33)37-30(2,3)4)28(32)36-27(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-18,24,26-27H,19-20H2,1-4H3/t24-,26+/m0/s1 |
| InChIKey | AOFNGIKTWKPHRW-AZGAKELHSA-N |
| XLogP | 5.41 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.66 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|