C32H44N2O4S — CID 10530747
2-cyclohexylsulfanyl-7-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)heptanenitrile (PubChem CID 10530747) has the molecular formula C32H44N2O4S and a molecular weight of 552.78 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-7-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)heptanenitrile.
| Compound Name | 2-cyclohexylsulfanyl-7-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)heptanenitrile |
|---|---|
| PubChem CID | 10530747 |
| Molecular Formula | C32H44N2O4S |
| Molecular Weight | 552.78 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | 2-cyclohexylsulfanyl-7-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)heptanenitrile |
| SMILES | COc1ccc(C(C#N)(CCCCCN2CCc3cc(OC)c(OC)cc3C2)SC2CCCCC2)cc1OC |
| InChI | InChI=1S/C32H44N2O4S/c1-35-28-14-13-26(21-31(28)38-4)32(23-33,39-27-11-7-5-8-12-27)16-9-6-10-17-34-18-15-24-19-29(36-2)30(37-3)20-25(24)22-34/h13-14,19-21,27H,5-12,15-18,22H2,1-4H3 |
| InChIKey | JRRLDSSCWZFHKN-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.78 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|