C10H16N6 — CID 105308264
[(1,5-dimethylpyrazol-4-yl)-(1-methylimidazol-2-yl)methyl]hydrazine (PubChem CID 105308264) has the molecular formula C10H16N6 and a molecular weight of 220.28 g/mol. Its IUPAC name is [(1,5-dimethylpyrazol-4-yl)-(1-methylimidazol-2-yl)methyl]hydrazine.
| Compound Name | [(1,5-dimethylpyrazol-4-yl)-(1-methylimidazol-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105308264 |
| Molecular Formula | C10H16N6 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | [(1,5-dimethylpyrazol-4-yl)-(1-methylimidazol-2-yl)methyl]hydrazine |
| SMILES | Cc1c(C(NN)c2nccn2C)cnn1C |
| InChI | InChI=1S/C10H16N6/c1-7-8(6-13-16(7)3)9(14-11)10-12-4-5-15(10)2/h4-6,9,14H,11H2,1-3H3 |
| InChIKey | KWEITMZQTAOIBT-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|