C13H17BrN4 — CID 105308418
[(3-bromo-4-methylphenyl)-(1-ethylimidazol-2-yl)methyl]hydrazine (PubChem CID 105308418) has the molecular formula C13H17BrN4 and a molecular weight of 309.21 g/mol. Its IUPAC name is [(3-bromo-4-methylphenyl)-(1-ethylimidazol-2-yl)methyl]hydrazine.
| Compound Name | [(3-bromo-4-methylphenyl)-(1-ethylimidazol-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105308418 |
| Molecular Formula | C13H17BrN4 |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | [(3-bromo-4-methylphenyl)-(1-ethylimidazol-2-yl)methyl]hydrazine |
| SMILES | CCn1ccnc1C(NN)c1ccc(C)c(Br)c1 |
| InChI | InChI=1S/C13H17BrN4/c1-3-18-7-6-16-13(18)12(17-15)10-5-4-9(2)11(14)8-10/h4-8,12,17H,3,15H2,1-2H3 |
| InChIKey | NGIZVQNNOTWDGR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|