C16H20N2S — CID 105308909
[1-(2,3-dihydro-1H-inden-5-yl)-3-thiophen-2-ylpropyl]hydrazine (PubChem CID 105308909) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is [1-(2,3-dihydro-1H-inden-5-yl)-3-thiophen-2-ylpropyl]hydrazine.
| Compound Name | [1-(2,3-dihydro-1H-inden-5-yl)-3-thiophen-2-ylpropyl]hydrazine |
|---|---|
| PubChem CID | 105308909 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | [1-(2,3-dihydro-1H-inden-5-yl)-3-thiophen-2-ylpropyl]hydrazine |
| SMILES | NNC(CCc1cccs1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H20N2S/c17-18-16(9-8-15-5-2-10-19-15)14-7-6-12-3-1-4-13(12)11-14/h2,5-7,10-11,16,18H,1,3-4,8-9,17H2 |
| InChIKey | WVXBDXGVIOSDIY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|