C36H49NO4 — CID 10530892
tert-butyl N-[(2S,3R)-3-hydroxy-1-trityloxydodecan-2-yl]carbamate (PubChem CID 10530892) has the molecular formula C36H49NO4 and a molecular weight of 559.79 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-3-hydroxy-1-trityloxydodecan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-3-hydroxy-1-trityloxydodecan-2-yl]carbamate |
|---|---|
| PubChem CID | 10530892 |
| Molecular Formula | C36H49NO4 |
| Molecular Weight | 559.79 g/mol |
| Exact Mass | 559.37 |
| IUPAC Name | tert-butyl N-[(2S,3R)-3-hydroxy-1-trityloxydodecan-2-yl]carbamate |
| SMILES | CCCCCCCCC[C@@H](O)[C@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H49NO4/c1-5-6-7-8-9-10-20-27-33(38)32(37-34(39)41-35(2,3)4)28-40-36(29-21-14-11-15-22-29,30-23-16-12-17-24-30)31-25-18-13-19-26-31/h11-19,21-26,32-33,38H,5-10,20,27-28H2,1-4H3,(H,37,39)/t32-,33+/m0/s1 |
| InChIKey | PSEKCFXZPWGKPO-JHOUSYSJSA-N |
| XLogP | 8.39 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.79 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|