C15H15Cl2FN2 — CID 105309794
[2-(2,5-dichlorophenyl)-1-(2-fluoro-5-methylphenyl)ethyl]hydrazine (PubChem CID 105309794) has the molecular formula C15H15Cl2FN2 and a molecular weight of 313.20 g/mol. Its IUPAC name is [2-(2,5-dichlorophenyl)-1-(2-fluoro-5-methylphenyl)ethyl]hydrazine.
| Compound Name | [2-(2,5-dichlorophenyl)-1-(2-fluoro-5-methylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105309794 |
| Molecular Formula | C15H15Cl2FN2 |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | [2-(2,5-dichlorophenyl)-1-(2-fluoro-5-methylphenyl)ethyl]hydrazine |
| SMILES | Cc1ccc(F)c(C(Cc2cc(Cl)ccc2Cl)NN)c1 |
| InChI | InChI=1S/C15H15Cl2FN2/c1-9-2-5-14(18)12(6-9)15(20-19)8-10-7-11(16)3-4-13(10)17/h2-7,15,20H,8,19H2,1H3 |
| InChIKey | QKBGWUJJRSMWMZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|