C33H44O6Si — CID 10530987
[(3R,5R,7S,9S)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-4,6,8-trioxadispiro[4.1.57.35]pentadec-13-en-3-yl]methyl acetate (PubChem CID 10530987) has the molecular formula C33H44O6Si and a molecular weight of 564.80 g/mol. Its IUPAC name is [(3R,5R,7S,9S)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-4,6,8-trioxadispiro[4.1.57.35]pentadec-13-en-3-yl]methyl acetate.
| Compound Name | [(3R,5R,7S,9S)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-4,6,8-trioxadispiro[4.1.57.35]pentadec-13-en-3-yl]methyl acetate |
|---|---|
| PubChem CID | 10530987 |
| Molecular Formula | C33H44O6Si |
| Molecular Weight | 564.80 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | [(3R,5R,7S,9S)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-4,6,8-trioxadispiro[4.1.57.35]pentadec-13-en-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(C)CC[C@@]2(CC=C[C@]3(CCC[C@@H](CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)O3)O2)O1 |
| InChI | InChI=1S/C33H44O6Si/c1-26(34)35-25-31(5)22-23-33(38-31)21-13-20-32(39-33)19-12-14-27(37-32)24-36-40(30(2,3)4,28-15-8-6-9-16-28)29-17-10-7-11-18-29/h6-11,13,15-18,20,27H,12,14,19,21-25H2,1-5H3/t27-,31+,32-,33-/m0/s1 |
| InChIKey | YWKUAUFZKVTNQT-NMMXFHACSA-N |
| XLogP | 5.63 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.80 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|