C16H19IN2 — CID 105310282
[1-(2,5-dimethylphenyl)-2-(4-iodophenyl)ethyl]hydrazine (PubChem CID 105310282) has the molecular formula C16H19IN2 and a molecular weight of 366.25 g/mol. Its IUPAC name is [1-(2,5-dimethylphenyl)-2-(4-iodophenyl)ethyl]hydrazine.
| Compound Name | [1-(2,5-dimethylphenyl)-2-(4-iodophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105310282 |
| Molecular Formula | C16H19IN2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | [1-(2,5-dimethylphenyl)-2-(4-iodophenyl)ethyl]hydrazine |
| SMILES | Cc1ccc(C)c(C(Cc2ccc(I)cc2)NN)c1 |
| InChI | InChI=1S/C16H19IN2/c1-11-3-4-12(2)15(9-11)16(19-18)10-13-5-7-14(17)8-6-13/h3-9,16,19H,10,18H2,1-2H3 |
| InChIKey | YPGACGNANNBLFK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|