C18H21BrN2 — CID 105310656
[1-(4-bromo-3-methylphenyl)-2-(2,3-dihydro-1H-inden-5-yl)ethyl]hydrazine (PubChem CID 105310656) has the molecular formula C18H21BrN2 and a molecular weight of 345.28 g/mol. Its IUPAC name is [1-(4-bromo-3-methylphenyl)-2-(2,3-dihydro-1H-inden-5-yl)ethyl]hydrazine.
| Compound Name | [1-(4-bromo-3-methylphenyl)-2-(2,3-dihydro-1H-inden-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105310656 |
| Molecular Formula | C18H21BrN2 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | [1-(4-bromo-3-methylphenyl)-2-(2,3-dihydro-1H-inden-5-yl)ethyl]hydrazine |
| SMILES | Cc1cc(C(Cc2ccc3c(c2)CCC3)NN)ccc1Br |
| InChI | InChI=1S/C18H21BrN2/c1-12-9-16(7-8-17(12)19)18(21-20)11-13-5-6-14-3-2-4-15(14)10-13/h5-10,18,21H,2-4,11,20H2,1H3 |
| InChIKey | VSUMJJCWSUKQCM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|